C19H17FN2O3S — CID 17403858
N-[3-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-3-oxopropyl]furan-2-carboxamide (PubChem CID 17403858) has the molecular formula C19H17FN2O3S and a molecular weight of 372.42 g/mol. Its IUPAC name is N-[3-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-3-oxopropyl]furan-2-carboxamide.
| Compound Name | N-[3-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-3-oxopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17403858 |
| Molecular Formula | C19H17FN2O3S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N-[3-[[(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-3-oxopropyl]furan-2-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccco1)NC(c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C19H17FN2O3S/c20-14-7-5-13(6-8-14)18(16-4-2-12-26-16)22-17(23)9-10-21-19(24)15-3-1-11-25-15/h1-8,11-12,18H,9-10H2,(H,21,24)(H,22,23) |
| InChIKey | SJFPSGUCAAFQNE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |