C16H19FN2OS — CID 61258454
N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-4-(methylamino)butanamide (PubChem CID 61258454) has the molecular formula C16H19FN2OS and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-4-(methylamino)butanamide.
| Compound Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 61258454 |
| Molecular Formula | C16H19FN2OS |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)NC(c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C16H19FN2OS/c1-18-10-2-5-15(20)19-16(14-4-3-11-21-14)12-6-8-13(17)9-7-12/h3-4,6-9,11,16,18H,2,5,10H2,1H3,(H,19,20) |
| InChIKey | FEBQAVUYDLSAFX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|