C18H18FNO3S — CID 9290917
[2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 3-methylbut-2-enoate (PubChem CID 9290917) has the molecular formula C18H18FNO3S and a molecular weight of 347.41 g/mol. Its IUPAC name is [2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 3-methylbut-2-enoate.
| Compound Name | [2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 9290917 |
| Molecular Formula | C18H18FNO3S |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | [2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OCC(=O)N[C@H](c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C18H18FNO3S/c1-12(2)10-17(22)23-11-16(21)20-18(15-4-3-9-24-15)13-5-7-14(19)8-6-13/h3-10,18H,11H2,1-2H3,(H,20,21)/t18-/m1/s1 |
| InChIKey | BTVVHJHJPJUXFF-GOSISDBHSA-N |
| XLogP | 3.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|