C20H16FNO3S2 — CID 8588237
[2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 8588237) has the molecular formula C20H16FNO3S2 and a molecular weight of 401.48 g/mol. Its IUPAC name is [2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8588237 |
| Molecular Formula | C20H16FNO3S2 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | [2-[[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]amino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccs1)N[C@H](c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C20H16FNO3S2/c21-15-7-5-14(6-8-15)20(17-4-2-12-27-17)22-18(23)13-25-19(24)10-9-16-3-1-11-26-16/h1-12,20H,13H2,(H,22,23)/b10-9+/t20-/m1/s1 |
| InChIKey | OFHCEGNCUZGWNX-SQUSKLHYSA-N |
| XLogP | 4.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|