C17H15FN2O4S — CID 8653884
[2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 8653884) has the molecular formula C17H15FN2O4S and a molecular weight of 362.38 g/mol. Its IUPAC name is [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8653884 |
| Molecular Formula | C17H15FN2O4S |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccs1)NCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H15FN2O4S/c18-12-3-5-13(6-4-12)20-15(21)10-19-16(22)11-24-17(23)8-7-14-2-1-9-25-14/h1-9H,10-11H2,(H,19,22)(H,20,21)/b8-7+ |
| InChIKey | GUJVJMZMNAJKQJ-BQYQJAHWSA-N |
| XLogP | 2.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|