C17H15NO4S — CID 2415375
[2-oxo-2-[(2-phenylacetyl)amino]ethyl] (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 2415375) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is [2-oxo-2-[(2-phenylacetyl)amino]ethyl] (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-oxo-2-[(2-phenylacetyl)amino]ethyl] (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 2415375 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | [2-oxo-2-[(2-phenylacetyl)amino]ethyl] (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccs1)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H15NO4S/c19-15(11-13-5-2-1-3-6-13)18-16(20)12-22-17(21)9-8-14-7-4-10-23-14/h1-10H,11-12H2,(H,18,19,20)/b9-8+ |
| InChIKey | RZHFHDAGXCXENS-CMDGGOBGSA-N |
| XLogP | 2.19 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|