C15H11Cl2NO3S — CID 3278809
[2-(2,3-dichloroanilino)-2-oxoethyl] 3-thiophen-2-ylprop-2-enoate (PubChem CID 3278809) has the molecular formula C15H11Cl2NO3S and a molecular weight of 356.23 g/mol. Its IUPAC name is [2-(2,3-dichloroanilino)-2-oxoethyl] 3-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 3278809 |
| Molecular Formula | C15H11Cl2NO3S |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 3-thiophen-2-ylprop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1cccs1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H11Cl2NO3S/c16-11-4-1-5-12(15(11)17)18-13(19)9-21-14(20)7-6-10-3-2-8-22-10/h1-8H,9H2,(H,18,19) |
| InChIKey | AMVAGYZZXGPXMY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|