C15H14N2O5S2 — CID 8648776
[2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 8648776) has the molecular formula C15H14N2O5S2 and a molecular weight of 366.42 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8648776 |
| Molecular Formula | C15H14N2O5S2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)COC(=O)/C=C/c2cccs2)c1 |
| InChI | InChI=1S/C15H14N2O5S2/c16-24(20,21)13-5-1-3-11(9-13)17-14(18)10-22-15(19)7-6-12-4-2-8-23-12/h1-9H,10H2,(H,17,18)(H2,16,20,21)/b7-6+ |
| InChIKey | NDUJGPCSSDVHIJ-VOTSOKGWSA-N |
| XLogP | 1.59 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|