C17H18N2O5S2 — CID 8648488
[2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 8648488) has the molecular formula C17H18N2O5S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8648488 |
| Molecular Formula | C17H18N2O5S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)COC(=O)/C=C/c2cccs2)cc1 |
| InChI | InChI=1S/C17H18N2O5S2/c1-19(2)26(22,23)15-8-5-13(6-9-15)18-16(20)12-24-17(21)10-7-14-4-3-11-25-14/h3-11H,12H2,1-2H3,(H,18,20)/b10-7+ |
| InChIKey | ZSCRCGCOCQYKHB-JXMROGBWSA-N |
| XLogP | 2.19 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|