C16H11ClF3NO3S — CID 71953929
[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-thiophen-2-ylprop-2-enoate (PubChem CID 71953929) has the molecular formula C16H11ClF3NO3S and a molecular weight of 389.78 g/mol. Its IUPAC name is [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 71953929 |
| Molecular Formula | C16H11ClF3NO3S |
| Molecular Weight | 389.78 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | [2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl] 3-thiophen-2-ylprop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1cccs1)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C16H11ClF3NO3S/c17-12-5-3-10(16(18,19)20)8-13(12)21-14(22)9-24-15(23)6-4-11-2-1-7-25-11/h1-8H,9H2,(H,21,22) |
| InChIKey | TZYBVAPZTNABAX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.78 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|