C16H14ClNO4S — CID 8653720
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 8653720) has the molecular formula C16H14ClNO4S and a molecular weight of 351.81 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8653720 |
| Molecular Formula | C16H14ClNO4S |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | COc1ccc(Cl)cc1NC(=O)COC(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C16H14ClNO4S/c1-21-14-6-4-11(17)9-13(14)18-15(19)10-22-16(20)7-5-12-3-2-8-23-12/h2-9H,10H2,1H3,(H,18,19)/b7-5+ |
| InChIKey | JDTSXNMLIWSVTG-FNORWQNLSA-N |
| XLogP | 3.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|