C20H16ClNO3S — CID 2101513
(E)-N-[5-chloro-2-(4-methoxyphenoxy)phenyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 2101513) has the molecular formula C20H16ClNO3S and a molecular weight of 385.87 g/mol. Its IUPAC name is (E)-N-[5-chloro-2-(4-methoxyphenoxy)phenyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[5-chloro-2-(4-methoxyphenoxy)phenyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 2101513 |
| Molecular Formula | C20H16ClNO3S |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | (E)-N-[5-chloro-2-(4-methoxyphenoxy)phenyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | COc1ccc(Oc2ccc(Cl)cc2NC(=O)/C=C/c2cccs2)cc1 |
| InChI | InChI=1S/C20H16ClNO3S/c1-24-15-5-7-16(8-6-15)25-19-10-4-14(21)13-18(19)22-20(23)11-9-17-3-2-12-26-17/h2-13H,1H3,(H,22,23)/b11-9+ |
| InChIKey | PFFSKIPAJMYZDX-PKNBQFBNSA-N |
| XLogP | 5.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|