C14H11ClN2O2S2 — CID 6234868
(E)-N-[(5-chloro-2-hydroxyphenyl)carbamothioyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 6234868) has the molecular formula C14H11ClN2O2S2 and a molecular weight of 338.84 g/mol. Its IUPAC name is (E)-N-[(5-chloro-2-hydroxyphenyl)carbamothioyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[(5-chloro-2-hydroxyphenyl)carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 6234868 |
| Molecular Formula | C14H11ClN2O2S2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | (E)-N-[(5-chloro-2-hydroxyphenyl)carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)NC(=S)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C14H11ClN2O2S2/c15-9-3-5-12(18)11(8-9)16-14(20)17-13(19)6-4-10-2-1-7-21-10/h1-8,18H,(H2,16,17,19,20)/b6-4+ |
| InChIKey | DUOUIWVVAMKJQW-GQCTYLIASA-N |
| XLogP | 3.63 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|