C14H10ClFN2OS2 — CID 4927312
N-[(3-chloro-4-fluorophenyl)carbamothioyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 4927312) has the molecular formula C14H10ClFN2OS2 and a molecular weight of 340.83 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)carbamothioyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 4927312 |
| Molecular Formula | C14H10ClFN2OS2 |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cccs1)NC(=S)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H10ClFN2OS2/c15-11-8-9(3-5-12(11)16)17-14(20)18-13(19)6-4-10-2-1-7-21-10/h1-8H,(H2,17,18,19,20) |
| InChIKey | MZLUARXHBHXWMP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|