C18H13F4NO3 — CID 4286970
[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-(4-fluorophenyl)prop-2-enoate (PubChem CID 4286970) has the molecular formula C18H13F4NO3 and a molecular weight of 367.30 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4286970 |
| Molecular Formula | C18H13F4NO3 |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-(4-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc(F)cc1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H13F4NO3/c19-14-6-1-12(2-7-14)3-10-17(25)26-11-16(24)23-15-8-4-13(5-9-15)18(20,21)22/h1-10H,11H2,(H,23,24) |
| InChIKey | WNSREXTXDBRVHS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|