C17H13F2NO3 — CID 2552357
[2-(3-fluoroanilino)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 2552357) has the molecular formula C17H13F2NO3 and a molecular weight of 317.29 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2552357 |
| Molecular Formula | C17H13F2NO3 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(F)cc1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C17H13F2NO3/c18-13-7-4-12(5-8-13)6-9-17(22)23-11-16(21)20-15-3-1-2-14(19)10-15/h1-10H,11H2,(H,20,21)/b9-6+ |
| InChIKey | XOBGZMLTLDQOBH-RMKNXTFCSA-N |
| XLogP | 3.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|