C24H20FNO4 — CID 18207237
[2-(3-fluoroanilino)-2-oxoethyl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate (PubChem CID 18207237) has the molecular formula C24H20FNO4 and a molecular weight of 405.43 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 18207237 |
| Molecular Formula | C24H20FNO4 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(OCc2ccccc2)cc1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C24H20FNO4/c25-20-7-4-8-21(15-20)26-23(27)17-30-24(28)14-11-18-9-12-22(13-10-18)29-16-19-5-2-1-3-6-19/h1-15H,16-17H2,(H,26,27)/b14-11+ |
| InChIKey | GYHRMFIGEJNKIM-SDNWHVSQSA-N |
| XLogP | 4.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|