C24H18Cl3NO4 — CID 4247600
[2-(3-chloroanilino)-2-oxoethyl] 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 4247600) has the molecular formula C24H18Cl3NO4 and a molecular weight of 490.77 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 4247600 |
| Molecular Formula | C24H18Cl3NO4 |
| Molecular Weight | 490.77 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc(OCc2c(Cl)cccc2Cl)cc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H18Cl3NO4/c25-17-3-1-4-18(13-17)28-23(29)15-32-24(30)12-9-16-7-10-19(11-8-16)31-14-20-21(26)5-2-6-22(20)27/h1-13H,14-15H2,(H,28,29) |
| InChIKey | WMHTWFDGHNWNDR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.77 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|