C25H21F2NO5 — CID 35777999
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate (PubChem CID 35777999) has the molecular formula C25H21F2NO5 and a molecular weight of 453.44 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 35777999 |
| Molecular Formula | C25H21F2NO5 |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(OCc2ccccc2)cc1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C25H21F2NO5/c26-25(27)33-22-9-5-4-8-21(22)28-23(29)17-32-24(30)15-12-18-10-13-20(14-11-18)31-16-19-6-2-1-3-7-19/h1-15,25H,16-17H2,(H,28,29)/b15-12+ |
| InChIKey | HWNAURJZNOWEMQ-NTCAYCPXSA-N |
| XLogP | 5.06 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|