C20H18F2N2O5 — CID 2128324
[2-(benzylcarbamoylamino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 2128324) has the molecular formula C20H18F2N2O5 and a molecular weight of 404.37 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-(benzylcarbamoylamino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 2128324 |
| Molecular Formula | C20H18F2N2O5 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | [2-(benzylcarbamoylamino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(OC(F)F)cc1)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H18F2N2O5/c21-19(22)29-16-9-6-14(7-10-16)8-11-18(26)28-13-17(25)24-20(27)23-12-15-4-2-1-3-5-15/h1-11,19H,12-13H2,(H2,23,24,25,27)/b11-8+ |
| InChIKey | PGCLHUPTFAWXJH-DHZHZOJOSA-N |
| XLogP | 2.87 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|