C20H19F2NO5 — CID 7996518
[2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 7996518) has the molecular formula C20H19F2NO5 and a molecular weight of 391.37 g/mol. Its IUPAC name is [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7996518 |
| Molecular Formula | C20H19F2NO5 |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | COc1cccc(CNC(=O)COC(=O)/C=C/c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C20H19F2NO5/c1-26-17-4-2-3-15(11-17)12-23-18(24)13-27-19(25)10-7-14-5-8-16(9-6-14)28-20(21)22/h2-11,20H,12-13H2,1H3,(H,23,24)/b10-7+ |
| InChIKey | CWPMOOJZNMEMNA-JXMROGBWSA-N |
| XLogP | 3.17 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|