C21H21F2NO6 — CID 2477417
[2-[(3,4-dimethoxyphenyl)methylamino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 2477417) has the molecular formula C21H21F2NO6 and a molecular weight of 421.40 g/mol. Its IUPAC name is [2-[(3,4-dimethoxyphenyl)methylamino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-[(3,4-dimethoxyphenyl)methylamino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 2477417 |
| Molecular Formula | C21H21F2NO6 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | [2-[(3,4-dimethoxyphenyl)methylamino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | COc1ccc(CNC(=O)COC(=O)/C=C/c2ccc(OC(F)F)cc2)cc1OC |
| InChI | InChI=1S/C21H21F2NO6/c1-27-17-9-5-15(11-18(17)28-2)12-24-19(25)13-29-20(26)10-6-14-3-7-16(8-4-14)30-21(22)23/h3-11,21H,12-13H2,1-2H3,(H,24,25)/b10-6+ |
| InChIKey | QQYJZKXMUDXOLR-UXBLZVDNSA-N |
| XLogP | 3.18 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|