C20H22F2N2O5 — CID 24511642
2-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]oxy-N-[(3,4-dimethoxyphenyl)methyl]propanamide (PubChem CID 24511642) has the molecular formula C20H22F2N2O5 and a molecular weight of 408.40 g/mol. Its IUPAC name is 2-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]oxy-N-[(3,4-dimethoxyphenyl)methyl]propanamide.
| Compound Name | 2-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]oxy-N-[(3,4-dimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 24511642 |
| Molecular Formula | C20H22F2N2O5 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]oxy-N-[(3,4-dimethoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CNC(=O)C(C)O/N=C/c2ccc(OC(F)F)cc2)cc1OC |
| InChI | InChI=1S/C20H22F2N2O5/c1-13(29-24-12-14-4-7-16(8-5-14)28-20(21)22)19(25)23-11-15-6-9-17(26-2)18(10-15)27-3/h4-10,12-13,20H,11H2,1-3H3,(H,23,25)/b24-12+ |
| InChIKey | FTKWTEQGUBPERG-WYMPLXKRSA-N |
| XLogP | 3.36 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|