C21H23F2NO6 — CID 27676534
(E)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 27676534) has the molecular formula C21H23F2NO6 and a molecular weight of 423.41 g/mol. Its IUPAC name is (E)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 27676534 |
| Molecular Formula | C21H23F2NO6 |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (E)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(CNC(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)ccc1OC(F)F |
| InChI | InChI=1S/C21H23F2NO6/c1-26-16-11-14(5-7-15(16)30-21(22)23)12-24-19(25)8-6-13-9-17(27-2)20(29-4)18(10-13)28-3/h5-11,21H,12H2,1-4H3,(H,24,25)/b8-6+ |
| InChIKey | HXYRTZQYPQQSLY-SOFGYWHQSA-N |
| XLogP | 3.65 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|