C20H21F2N3O5 — CID 55870520
2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-[(3,4-dimethoxyphenyl)methyl]propanamide (PubChem CID 55870520) has the molecular formula C20H21F2N3O5 and a molecular weight of 421.40 g/mol. Its IUPAC name is 2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-[(3,4-dimethoxyphenyl)methyl]propanamide.
| Compound Name | 2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-[(3,4-dimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 55870520 |
| Molecular Formula | C20H21F2N3O5 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-[(3,4-dimethoxyphenyl)methyl]propanamide |
| SMILES | COc1ccc(CNC(=O)C(C)O/N=C/C(=O)Nc2ccc(F)cc2F)cc1OC |
| InChI | InChI=1S/C20H21F2N3O5/c1-12(20(27)23-10-13-4-7-17(28-2)18(8-13)29-3)30-24-11-19(26)25-16-6-5-14(21)9-15(16)22/h4-9,11-12H,10H2,1-3H3,(H,23,27)(H,25,26)/b24-11+ |
| InChIKey | PKYZUKXOOWLPSV-BHGWPJFGSA-N |
| XLogP | 2.63 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|