C18H14F2N4O3 — CID 60528886
N-(3-cyanophenyl)-2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxypropanamide (PubChem CID 60528886) has the molecular formula C18H14F2N4O3 and a molecular weight of 372.33 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxypropanamide.
| Compound Name | N-(3-cyanophenyl)-2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxypropanamide |
|---|---|
| PubChem CID | 60528886 |
| Molecular Formula | C18H14F2N4O3 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-(3-cyanophenyl)-2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxypropanamide |
| SMILES | CC(O/N=C/C(=O)Nc1ccc(F)cc1F)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C18H14F2N4O3/c1-11(18(26)23-14-4-2-3-12(7-14)9-21)27-22-10-17(25)24-16-6-5-13(19)8-15(16)20/h2-8,10-11H,1H3,(H,23,26)(H,24,25)/b22-10+ |
| InChIKey | NOELCMBNCXWUPZ-LSHDLFTRSA-N |
| XLogP | 2.80 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|