C20H21F2N3O6 — CID 55871035
2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide (PubChem CID 55871035) has the molecular formula C20H21F2N3O6 and a molecular weight of 437.40 g/mol. Its IUPAC name is 2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 55871035 |
| Molecular Formula | C20H21F2N3O6 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-[(3,4,5-trimethoxyphenyl)methyl]acetamide |
| SMILES | COc1cc(CNC(=O)CO/N=C/C(=O)Nc2ccc(F)cc2F)cc(OC)c1OC |
| InChI | InChI=1S/C20H21F2N3O6/c1-28-16-6-12(7-17(29-2)20(16)30-3)9-23-19(27)11-31-24-10-18(26)25-15-5-4-13(21)8-14(15)22/h4-8,10H,9,11H2,1-3H3,(H,23,27)(H,25,26)/b24-10+ |
| InChIKey | NQJUOSKECIMYQB-YSURURNPSA-N |
| XLogP | 2.25 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|