C18H19F2NO4 — CID 2711396
N-(2,5-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 2711396) has the molecular formula C18H19F2NO4 and a molecular weight of 351.35 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-(2,5-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 2711396 |
| Molecular Formula | C18H19F2NO4 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-(2,5-difluorophenyl)-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(CCC(=O)Nc2cc(F)ccc2F)cc(OC)c1OC |
| InChI | InChI=1S/C18H19F2NO4/c1-23-15-8-11(9-16(24-2)18(15)25-3)4-7-17(22)21-14-10-12(19)5-6-13(14)20/h5-6,8-10H,4,7H2,1-3H3,(H,21,22) |
| InChIKey | WBTDJLXGAPUFJX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |