C18H19ClFNO4 — CID 2683148
N-(3-chloro-4-fluorophenyl)-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 2683148) has the molecular formula C18H19ClFNO4 and a molecular weight of 367.80 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 2683148 |
| Molecular Formula | C18H19ClFNO4 |
| Molecular Weight | 367.80 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(CCC(=O)Nc2ccc(F)c(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H19ClFNO4/c1-23-15-8-11(9-16(24-2)18(15)25-3)4-7-17(22)21-12-5-6-14(20)13(19)10-12/h5-6,8-10H,4,7H2,1-3H3,(H,21,22) |
| InChIKey | XHVXTTKJDZHPCQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.80 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |