C19H23NO5 — CID 9495575
N-(2-hydroxy-4-methylphenyl)-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 9495575) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-(2-hydroxy-4-methylphenyl)-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-(2-hydroxy-4-methylphenyl)-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 9495575 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-(2-hydroxy-4-methylphenyl)-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(CCC(=O)Nc2ccc(C)cc2O)cc(OC)c1OC |
| InChI | InChI=1S/C19H23NO5/c1-12-5-7-14(15(21)9-12)20-18(22)8-6-13-10-16(23-2)19(25-4)17(11-13)24-3/h5,7,9-11,21H,6,8H2,1-4H3,(H,20,22) |
| InChIKey | XUNCTERDCOOTSF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|