C18H20FNO4 — CID 26522941
N-(2-fluoro-4-methylphenyl)-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 26522941) has the molecular formula C18H20FNO4 and a molecular weight of 333.36 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-(2-fluoro-4-methylphenyl)-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 26522941 |
| Molecular Formula | C18H20FNO4 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)Nc2ccc(C)cc2F)cc(OC)c1OC |
| InChI | InChI=1S/C18H20FNO4/c1-11-5-6-14(13(19)7-11)20-17(21)10-12-8-15(22-2)18(24-4)16(9-12)23-3/h5-9H,10H2,1-4H3,(H,20,21) |
| InChIKey | DJVISRCTVJNFOM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |