C17H15F2N3O3 — CID 60528918
2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-(4-methylphenyl)acetamide (PubChem CID 60528918) has the molecular formula C17H15F2N3O3 and a molecular weight of 347.32 g/mol. Its IUPAC name is 2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 60528918 |
| Molecular Formula | C17H15F2N3O3 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-[(E)-[2-(2,4-difluoroanilino)-2-oxoethylidene]amino]oxy-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CO/N=C/C(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H15F2N3O3/c1-11-2-5-13(6-3-11)21-17(24)10-25-20-9-16(23)22-15-7-4-12(18)8-14(15)19/h2-9H,10H2,1H3,(H,21,24)(H,22,23)/b20-9+ |
| InChIKey | HGHILUKQMONFMD-AWQFTUOYSA-N |
| XLogP | 2.85 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|