C19H15F6N3O3 — CID 6904540
N-[3,5-bis(trifluoromethyl)phenyl]-2-[(E)-[2-(4-methylanilino)-2-oxoethylidene]amino]oxyacetamide (PubChem CID 6904540) has the molecular formula C19H15F6N3O3 and a molecular weight of 447.34 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-[(E)-[2-(4-methylanilino)-2-oxoethylidene]amino]oxyacetamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-[(E)-[2-(4-methylanilino)-2-oxoethylidene]amino]oxyacetamide |
|---|---|
| PubChem CID | 6904540 |
| Molecular Formula | C19H15F6N3O3 |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-[(E)-[2-(4-methylanilino)-2-oxoethylidene]amino]oxyacetamide |
| SMILES | Cc1ccc(NC(=O)/C=N/OCC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H15F6N3O3/c1-11-2-4-14(5-3-11)27-16(29)9-26-31-10-17(30)28-15-7-12(18(20,21)22)6-13(8-15)19(23,24)25/h2-9H,10H2,1H3,(H,27,29)(H,28,30)/b26-9+ |
| InChIKey | AAIPFKMXDZMFLC-JQAMDZJQSA-N |
| XLogP | 4.61 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|