C21H19F3N4O3 — CID 6904886
N-(2-cyanoethyl)-2-[(E)-[2-(4-methylanilino)-2-oxoethylidene]amino]oxy-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 6904886) has the molecular formula C21H19F3N4O3 and a molecular weight of 432.40 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[(E)-[2-(4-methylanilino)-2-oxoethylidene]amino]oxy-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[(E)-[2-(4-methylanilino)-2-oxoethylidene]amino]oxy-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 6904886 |
| Molecular Formula | C21H19F3N4O3 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-(2-cyanoethyl)-2-[(E)-[2-(4-methylanilino)-2-oxoethylidene]amino]oxy-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)/C=N/OCC(=O)N(CCC#N)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H19F3N4O3/c1-15-6-8-17(9-7-15)27-19(29)13-26-31-14-20(30)28(11-3-10-25)18-5-2-4-16(12-18)21(22,23)24/h2,4-9,12-13H,3,11,14H2,1H3,(H,27,29)/b26-13+ |
| InChIKey | WDKITFPJGRAJEN-LGJNPRDNSA-N |
| XLogP | 3.90 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|