C18H22F3N3O3 — CID 3456323
2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]imino-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 3456323) has the molecular formula C18H22F3N3O3 and a molecular weight of 385.39 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]imino-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]imino-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3456323 |
| Molecular Formula | C18H22F3N3O3 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]imino-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC1CC(C)CN(C(=O)CON=CC(=O)Nc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C18H22F3N3O3/c1-12-6-13(2)10-24(9-12)17(26)11-27-22-8-16(25)23-15-5-3-4-14(7-15)18(19,20)21/h3-5,7-8,12-13H,6,9-11H2,1-2H3,(H,23,25) |
| InChIKey | RHFYGWZRNHQSAS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|