C19H17F3N4O4 — CID 24581644
N-methyl-3-[[2-[(E)-[2-oxo-2-[3-(trifluoromethyl)anilino]ethylidene]amino]oxyacetyl]amino]benzamide (PubChem CID 24581644) has the molecular formula C19H17F3N4O4 and a molecular weight of 422.36 g/mol. Its IUPAC name is N-methyl-3-[[2-[(E)-[2-oxo-2-[3-(trifluoromethyl)anilino]ethylidene]amino]oxyacetyl]amino]benzamide.
| Compound Name | N-methyl-3-[[2-[(E)-[2-oxo-2-[3-(trifluoromethyl)anilino]ethylidene]amino]oxyacetyl]amino]benzamide |
|---|---|
| PubChem CID | 24581644 |
| Molecular Formula | C19H17F3N4O4 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-methyl-3-[[2-[(E)-[2-oxo-2-[3-(trifluoromethyl)anilino]ethylidene]amino]oxyacetyl]amino]benzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)CO/N=C/C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H17F3N4O4/c1-23-18(29)12-4-2-6-14(8-12)26-17(28)11-30-24-10-16(27)25-15-7-3-5-13(9-15)19(20,21)22/h2-10H,11H2,1H3,(H,23,29)(H,25,27)(H,26,28)/b24-10+ |
| InChIKey | DOSODQLTHPGKKS-YSURURNPSA-N |
| XLogP | 2.64 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|