C18H16F3N3O3S — CID 24606203
(2E)-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethoxy]imino-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 24606203) has the molecular formula C18H16F3N3O3S and a molecular weight of 411.41 g/mol. Its IUPAC name is (2E)-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethoxy]imino-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | (2E)-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethoxy]imino-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24606203 |
| Molecular Formula | C18H16F3N3O3S |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (2E)-2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethoxy]imino-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(/C=N/OCC(=O)N1CCc2sccc2C1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F3N3O3S/c19-18(20,21)13-2-1-3-14(8-13)23-16(25)9-22-27-11-17(26)24-6-4-15-12(10-24)5-7-28-15/h1-3,5,7-9H,4,6,10-11H2,(H,23,25)/b22-9+ |
| InChIKey | WHIGFKXGZKIPEL-LSFURLLWSA-N |
| XLogP | 3.29 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|