C15H19F3N2S — CID 19654078
3,5-dimethyl-N-[3-(trifluoromethyl)phenyl]piperidine-1-carbothioamide (PubChem CID 19654078) has the molecular formula C15H19F3N2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 3,5-dimethyl-N-[3-(trifluoromethyl)phenyl]piperidine-1-carbothioamide.
| Compound Name | 3,5-dimethyl-N-[3-(trifluoromethyl)phenyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 19654078 |
| Molecular Formula | C15H19F3N2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 3,5-dimethyl-N-[3-(trifluoromethyl)phenyl]piperidine-1-carbothioamide |
| SMILES | CC1CC(C)CN(C(=S)Nc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H19F3N2S/c1-10-6-11(2)9-20(8-10)14(21)19-13-5-3-4-12(7-13)15(16,17)18/h3-5,7,10-11H,6,8-9H2,1-2H3,(H,19,21) |
| InChIKey | SAEMJVBXDNWPNM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|