C15H18F3N3OS — CID 134118268
N-[1-[[3-(trifluoromethyl)phenyl]carbamothioyl]piperidin-3-yl]acetamide (PubChem CID 134118268) has the molecular formula C15H18F3N3OS and a molecular weight of 345.39 g/mol. Its IUPAC name is N-[1-[[3-(trifluoromethyl)phenyl]carbamothioyl]piperidin-3-yl]acetamide.
| Compound Name | N-[1-[[3-(trifluoromethyl)phenyl]carbamothioyl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 134118268 |
| Molecular Formula | C15H18F3N3OS |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[1-[[3-(trifluoromethyl)phenyl]carbamothioyl]piperidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCCN(C(=S)Nc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H18F3N3OS/c1-10(22)19-13-6-3-7-21(9-13)14(23)20-12-5-2-4-11(8-12)15(16,17)18/h2,4-5,8,13H,3,6-7,9H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | MMGZPCUQZWSZGA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|