C14H16F3N3O2 — CID 5297464
1-N-[3-(trifluoromethyl)phenyl]piperidine-1,3-dicarboxamide (PubChem CID 5297464) has the molecular formula C14H16F3N3O2 and a molecular weight of 315.29 g/mol. Its IUPAC name is 1-N-[3-(trifluoromethyl)phenyl]piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-[3-(trifluoromethyl)phenyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 5297464 |
| Molecular Formula | C14H16F3N3O2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-N-[3-(trifluoromethyl)phenyl]piperidine-1,3-dicarboxamide |
| SMILES | NC(=O)C1CCCN(C(=O)Nc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H16F3N3O2/c15-14(16,17)10-4-1-5-11(7-10)19-13(22)20-6-2-3-9(8-20)12(18)21/h1,4-5,7,9H,2-3,6,8H2,(H2,18,21)(H,19,22) |
| InChIKey | VKAJDJJCHLCGPG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |