C22H23F3N2O3 — CID 71086529
ethyl 1-[[4-[3-(trifluoromethyl)phenyl]phenyl]carbamoyl]piperidine-3-carboxylate (PubChem CID 71086529) has the molecular formula C22H23F3N2O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is ethyl 1-[[4-[3-(trifluoromethyl)phenyl]phenyl]carbamoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[[4-[3-(trifluoromethyl)phenyl]phenyl]carbamoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 71086529 |
| Molecular Formula | C22H23F3N2O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | ethyl 1-[[4-[3-(trifluoromethyl)phenyl]phenyl]carbamoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)Nc2ccc(-c3cccc(C(F)(F)F)c3)cc2)C1 |
| InChI | InChI=1S/C22H23F3N2O3/c1-2-30-20(28)17-6-4-12-27(14-17)21(29)26-19-10-8-15(9-11-19)16-5-3-7-18(13-16)22(23,24)25/h3,5,7-11,13,17H,2,4,6,12,14H2,1H3,(H,26,29) |
| InChIKey | CSDILKWFTHSMAP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |