C25H23F3N2O3 — CID 58874811
ethyl 1-[2-[3-(trifluoromethyl)phenyl]quinoline-6-carbonyl]piperidine-3-carboxylate (PubChem CID 58874811) has the molecular formula C25H23F3N2O3 and a molecular weight of 456.46 g/mol. Its IUPAC name is ethyl 1-[2-[3-(trifluoromethyl)phenyl]quinoline-6-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[3-(trifluoromethyl)phenyl]quinoline-6-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 58874811 |
| Molecular Formula | C25H23F3N2O3 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | ethyl 1-[2-[3-(trifluoromethyl)phenyl]quinoline-6-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2ccc3nc(-c4cccc(C(F)(F)F)c4)ccc3c2)C1 |
| InChI | InChI=1S/C25H23F3N2O3/c1-2-33-24(32)19-6-4-12-30(15-19)23(31)18-9-11-22-17(13-18)8-10-21(29-22)16-5-3-7-20(14-16)25(26,27)28/h3,5,7-11,13-14,19H,2,4,6,12,15H2,1H3 |
| InChIKey | KVCWLVUFMPWZIN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |