C24H23F3N2O2 — CID 156537969
ethyl 1-[6-[3-(trifluoromethyl)phenyl]quinolin-2-yl]piperidine-4-carboxylate (PubChem CID 156537969) has the molecular formula C24H23F3N2O2 and a molecular weight of 428.45 g/mol. Its IUPAC name is ethyl 1-[6-[3-(trifluoromethyl)phenyl]quinolin-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-[3-(trifluoromethyl)phenyl]quinolin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 156537969 |
| Molecular Formula | C24H23F3N2O2 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | ethyl 1-[6-[3-(trifluoromethyl)phenyl]quinolin-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc3cc(-c4cccc(C(F)(F)F)c4)ccc3n2)CC1 |
| InChI | InChI=1S/C24H23F3N2O2/c1-2-31-23(30)16-10-12-29(13-11-16)22-9-7-19-14-18(6-8-21(19)28-22)17-4-3-5-20(15-17)24(25,26)27/h3-9,14-16H,2,10-13H2,1H3 |
| InChIKey | WQSZNWURDTXRGJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |