C21H22F3N3O3 — CID 9228267
ethyl 3-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carbonyl]amino]benzoate (PubChem CID 9228267) has the molecular formula C21H22F3N3O3 and a molecular weight of 421.42 g/mol. Its IUPAC name is ethyl 3-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carbonyl]amino]benzoate.
| Compound Name | ethyl 3-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 9228267 |
| Molecular Formula | C21H22F3N3O3 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | ethyl 3-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)C2CCN(c3ccc(C(F)(F)F)cn3)CC2)c1 |
| InChI | InChI=1S/C21H22F3N3O3/c1-2-30-20(29)15-4-3-5-17(12-15)26-19(28)14-8-10-27(11-9-14)18-7-6-16(13-25-18)21(22,23)24/h3-7,12-14H,2,8-11H2,1H3,(H,26,28) |
| InChIKey | TZNGPJWOYVTLPJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |