C24H30ClN3O3 — CID 24751145
ethyl 6-[4-[(4-tert-butylphenyl)carbamoyl]piperidin-1-yl]-5-chloropyridine-3-carboxylate (PubChem CID 24751145) has the molecular formula C24H30ClN3O3 and a molecular weight of 443.98 g/mol. Its IUPAC name is ethyl 6-[4-[(4-tert-butylphenyl)carbamoyl]piperidin-1-yl]-5-chloropyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-[(4-tert-butylphenyl)carbamoyl]piperidin-1-yl]-5-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 24751145 |
| Molecular Formula | C24H30ClN3O3 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | ethyl 6-[4-[(4-tert-butylphenyl)carbamoyl]piperidin-1-yl]-5-chloropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2CCC(C(=O)Nc3ccc(C(C)(C)C)cc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C24H30ClN3O3/c1-5-31-23(30)17-14-20(25)21(26-15-17)28-12-10-16(11-13-28)22(29)27-19-8-6-18(7-9-19)24(2,3)4/h6-9,14-16H,5,10-13H2,1-4H3,(H,27,29) |
| InChIKey | GMFJDRYKAXJYLK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |