C13H20Cl3N3O2 — CID 68842869
ethyl 6-(4-aminopiperidin-1-yl)-5-chloropyridine-3-carboxylate;dihydrochloride (PubChem CID 68842869) has the molecular formula C13H20Cl3N3O2 and a molecular weight of 356.68 g/mol. Its IUPAC name is ethyl 6-(4-aminopiperidin-1-yl)-5-chloropyridine-3-carboxylate;dihydrochloride.
| Compound Name | ethyl 6-(4-aminopiperidin-1-yl)-5-chloropyridine-3-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 68842869 |
| Molecular Formula | C13H20Cl3N3O2 |
| Molecular Weight | 356.68 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | ethyl 6-(4-aminopiperidin-1-yl)-5-chloropyridine-3-carboxylate;dihydrochloride |
| SMILES | CCOC(=O)c1cnc(N2CCC(N)CC2)c(Cl)c1.Cl.Cl |
| InChI | InChI=1S/C13H18ClN3O2.2ClH/c1-2-19-13(18)9-7-11(14)12(16-8-9)17-5-3-10(15)4-6-17;;/h7-8,10H,2-6,15H2,1H3;2*1H |
| InChIKey | OMFJIYHPLWNGOH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.68 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |