C21H21ClN4O3S2 — CID 141193588
ethyl 6-[4-(2-benzamido-2-sulfanylideneethanethioyl)piperazin-1-yl]-5-chloropyridine-3-carboxylate (PubChem CID 141193588) has the molecular formula C21H21ClN4O3S2 and a molecular weight of 477.01 g/mol. Its IUPAC name is ethyl 6-[4-(2-benzamido-2-sulfanylideneethanethioyl)piperazin-1-yl]-5-chloropyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-(2-benzamido-2-sulfanylideneethanethioyl)piperazin-1-yl]-5-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 141193588 |
| Molecular Formula | C21H21ClN4O3S2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | ethyl 6-[4-(2-benzamido-2-sulfanylideneethanethioyl)piperazin-1-yl]-5-chloropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2CCN(C(=S)C(=S)NC(=O)c3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C21H21ClN4O3S2/c1-2-29-21(28)15-12-16(22)17(23-13-15)25-8-10-26(11-9-25)20(31)19(30)24-18(27)14-6-4-3-5-7-14/h3-7,12-13H,2,8-11H2,1H3,(H,24,27,30) |
| InChIKey | SMHGTHIYGUMQGX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|