C19H23ClN4O3S — CID 54584960
ethyl 5-chloro-6-[4-(2-thiophen-2-ylethylcarbamoyl)piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 54584960) has the molecular formula C19H23ClN4O3S and a molecular weight of 422.94 g/mol. Its IUPAC name is ethyl 5-chloro-6-[4-(2-thiophen-2-ylethylcarbamoyl)piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 5-chloro-6-[4-(2-thiophen-2-ylethylcarbamoyl)piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 54584960 |
| Molecular Formula | C19H23ClN4O3S |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | ethyl 5-chloro-6-[4-(2-thiophen-2-ylethylcarbamoyl)piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(N2CCN(C(=O)NCCc3cccs3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C19H23ClN4O3S/c1-2-27-18(25)14-12-16(20)17(22-13-14)23-7-9-24(10-8-23)19(26)21-6-5-15-4-3-11-28-15/h3-4,11-13H,2,5-10H2,1H3,(H,21,26) |
| InChIKey | XUQNUGXXFSUGFH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |