C16H19N3O2S2 — CID 121496273
4-(thiophene-2-carbonyl)-N-(2-thiophen-2-ylethyl)piperazine-1-carboxamide (PubChem CID 121496273) has the molecular formula C16H19N3O2S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 4-(thiophene-2-carbonyl)-N-(2-thiophen-2-ylethyl)piperazine-1-carboxamide.
| Compound Name | 4-(thiophene-2-carbonyl)-N-(2-thiophen-2-ylethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 121496273 |
| Molecular Formula | C16H19N3O2S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 4-(thiophene-2-carbonyl)-N-(2-thiophen-2-ylethyl)piperazine-1-carboxamide |
| SMILES | O=C(NCCc1cccs1)N1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C16H19N3O2S2/c20-15(14-4-2-12-23-14)18-7-9-19(10-8-18)16(21)17-6-5-13-3-1-11-22-13/h1-4,11-12H,5-10H2,(H,17,21) |
| InChIKey | ZQTHJMSWUCQSDO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |