C12H17N3O2S — CID 97212820
N-methyl-4-(thiophene-2-carbonyl)-1,4-diazepane-1-carboxamide (PubChem CID 97212820) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-methyl-4-(thiophene-2-carbonyl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-methyl-4-(thiophene-2-carbonyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 97212820 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-methyl-4-(thiophene-2-carbonyl)-1,4-diazepane-1-carboxamide |
| SMILES | CNC(=O)N1CCCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C12H17N3O2S/c1-13-12(17)15-6-3-5-14(7-8-15)11(16)10-4-2-9-18-10/h2,4,9H,3,5-8H2,1H3,(H,13,17) |
| InChIKey | YWEQZADZELQROG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |